C30H51N3O — CID 23141719
1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-methoxy-4-piperidin-1-ylphenyl]piperazine (PubChem CID 23141719) has the molecular formula C30H51N3O and a molecular weight of 469.76 g/mol. Its IUPAC name is 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-methoxy-4-piperidin-1-ylphenyl]piperazine.
| Compound Name | 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-methoxy-4-piperidin-1-ylphenyl]piperazine |
|---|---|
| PubChem CID | 23141719 |
| Molecular Formula | C30H51N3O |
| Molecular Weight | 469.76 g/mol |
| Exact Mass | 469.40 |
| IUPAC Name | 1-butyl-4-[2-(4-tert-butylcyclohexyl)-5-methoxy-4-piperidin-1-ylphenyl]piperazine |
| SMILES | CCCCN1CCN(c2cc(OC)c(N3CCCCC3)cc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C30H51N3O/c1-6-7-15-31-18-20-33(21-19-31)27-23-29(34-5)28(32-16-9-8-10-17-32)22-26(27)24-11-13-25(14-12-24)30(2,3)4/h22-25H,6-21H2,1-5H3 |
| InChIKey | IYWNPKQKFDBBDZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |