C29H49N3O2 — CID 23142601
4-[4-(4-tert-butylcyclohexyl)-5-(4-butylpiperazin-1-yl)-2-methoxyphenyl]morpholine (PubChem CID 23142601) has the molecular formula C29H49N3O2 and a molecular weight of 471.73 g/mol. Its IUPAC name is 4-[4-(4-tert-butylcyclohexyl)-5-(4-butylpiperazin-1-yl)-2-methoxyphenyl]morpholine.
| Compound Name | 4-[4-(4-tert-butylcyclohexyl)-5-(4-butylpiperazin-1-yl)-2-methoxyphenyl]morpholine |
|---|---|
| PubChem CID | 23142601 |
| Molecular Formula | C29H49N3O2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.38 |
| IUPAC Name | 4-[4-(4-tert-butylcyclohexyl)-5-(4-butylpiperazin-1-yl)-2-methoxyphenyl]morpholine |
| SMILES | CCCCN1CCN(c2cc(N3CCOCC3)c(OC)cc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C29H49N3O2/c1-6-7-12-30-13-15-31(16-14-30)26-22-27(32-17-19-34-20-18-32)28(33-5)21-25(26)23-8-10-24(11-9-23)29(2,3)4/h21-24H,6-20H2,1-5H3 |
| InChIKey | MTIWWLBDCWNSBI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|