C26H42N2O3 — CID 23141663
2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenoxy]acetic acid (PubChem CID 23141663) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 23141663 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 2-[4-(4-tert-butylcyclohexyl)-3-(4-butylpiperazin-1-yl)phenoxy]acetic acid |
| SMILES | CCCCN1CCN(c2cc(OCC(=O)O)ccc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C26H42N2O3/c1-5-6-13-27-14-16-28(17-15-27)24-18-22(31-19-25(29)30)11-12-23(24)20-7-9-21(10-8-20)26(2,3)4/h11-12,18,20-21H,5-10,13-17,19H2,1-4H3,(H,29,30) |
| InChIKey | QXHMPDYRCBSYBT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |