C24H38N2O2 — CID 174516681
4-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]butanoic acid (PubChem CID 174516681) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]butanoic acid.
| Compound Name | 4-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 174516681 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 4-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]butanoic acid |
| SMILES | CC(C)(C)C1CCC(c2ccccc2N2CCN(CCCC(=O)O)CC2)CC1 |
| InChI | InChI=1S/C24H38N2O2/c1-24(2,3)20-12-10-19(11-13-20)21-7-4-5-8-22(21)26-17-15-25(16-18-26)14-6-9-23(27)28/h4-5,7-8,19-20H,6,9-18H2,1-3H3,(H,27,28) |
| InChIKey | KHJIMZBWHJULCF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |