C23H36N2O2 — CID 59769450
ethyl 4-[2-(4-tert-butylcyclohexyl)phenyl]piperazine-1-carboxylate (PubChem CID 59769450) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is ethyl 4-[2-(4-tert-butylcyclohexyl)phenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-tert-butylcyclohexyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59769450 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | ethyl 4-[2-(4-tert-butylcyclohexyl)phenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccccc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C23H36N2O2/c1-5-27-22(26)25-16-14-24(15-17-25)21-9-7-6-8-20(21)18-10-12-19(13-11-18)23(2,3)4/h6-9,18-19H,5,10-17H2,1-4H3 |
| InChIKey | AFOHMUZNANERFO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |