C26H43ClN2 — CID 23141796
1-[2-(4-tert-butylcyclohexyl)phenyl]-4-(cyclopentylmethyl)piperazine;hydrochloride (PubChem CID 23141796) has the molecular formula C26H43ClN2 and a molecular weight of 419.10 g/mol. Its IUPAC name is 1-[2-(4-tert-butylcyclohexyl)phenyl]-4-(cyclopentylmethyl)piperazine;hydrochloride.
| Compound Name | 1-[2-(4-tert-butylcyclohexyl)phenyl]-4-(cyclopentylmethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 23141796 |
| Molecular Formula | C26H43ClN2 |
| Molecular Weight | 419.10 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 1-[2-(4-tert-butylcyclohexyl)phenyl]-4-(cyclopentylmethyl)piperazine;hydrochloride |
| SMILES | CC(C)(C)C1CCC(c2ccccc2N2CCN(CC3CCCC3)CC2)CC1.Cl |
| InChI | InChI=1S/C26H42N2.ClH/c1-26(2,3)23-14-12-22(13-15-23)24-10-6-7-11-25(24)28-18-16-27(17-19-28)20-21-8-4-5-9-21;/h6-7,10-11,21-23H,4-5,8-9,12-20H2,1-3H3;1H |
| InChIKey | KFSILXFZSBRLIA-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.10 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |