C29H46N2O — CID 150075303
1-[2-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]cyclohexyl]propan-1-one (PubChem CID 150075303) has the molecular formula C29H46N2O and a molecular weight of 438.70 g/mol. Its IUPAC name is 1-[2-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]cyclohexyl]propan-1-one.
| Compound Name | 1-[2-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 150075303 |
| Molecular Formula | C29H46N2O |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.36 |
| IUPAC Name | 1-[2-[4-[2-(4-tert-butylcyclohexyl)phenyl]piperazin-1-yl]cyclohexyl]propan-1-one |
| SMILES | CCC(=O)C1CCCCC1N1CCN(c2ccccc2C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C29H46N2O/c1-5-28(32)25-11-7-9-13-27(25)31-20-18-30(19-21-31)26-12-8-6-10-24(26)22-14-16-23(17-15-22)29(2,3)4/h6,8,10,12,22-23,25,27H,5,7,9,11,13-21H2,1-4H3 |
| InChIKey | DQDGDSNOOZZRIE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |