C24H38N2 — CID 23141887
1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazine (PubChem CID 23141887) has the molecular formula C24H38N2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazine.
| Compound Name | 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 23141887 |
| Molecular Formula | C24H38N2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 1-butyl-4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazine |
| SMILES | CCCCN1CCN(c2ccccc2C2=CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H38N2/c1-5-6-15-25-16-18-26(19-17-25)23-10-8-7-9-22(23)20-11-13-21(14-12-20)24(2,3)4/h7-11,21H,5-6,12-19H2,1-4H3 |
| InChIKey | UIXLDNWEBDVHFB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |