C24H37N3O — CID 69220329
2-[4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazin-1-yl]-N-ethylacetamide (PubChem CID 69220329) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-[4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 69220329 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 2-[4-[2-(4-tert-butylcyclohexen-1-yl)phenyl]piperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(c2ccccc2C2=CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C24H37N3O/c1-5-25-23(28)18-26-14-16-27(17-15-26)22-9-7-6-8-21(22)19-10-12-20(13-11-19)24(2,3)4/h6-10,20H,5,11-18H2,1-4H3,(H,25,28) |
| InChIKey | MKMCASOJSVTKGR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |