C29H47N3O2 — CID 143370163
8-[4-(4-butylpiperazin-1-yl)-3-(4-ethylcyclohexyl)phenyl]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 143370163) has the molecular formula C29H47N3O2 and a molecular weight of 469.71 g/mol. Its IUPAC name is 8-[4-(4-butylpiperazin-1-yl)-3-(4-ethylcyclohexyl)phenyl]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-[4-(4-butylpiperazin-1-yl)-3-(4-ethylcyclohexyl)phenyl]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 143370163 |
| Molecular Formula | C29H47N3O2 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.37 |
| IUPAC Name | 8-[4-(4-butylpiperazin-1-yl)-3-(4-ethylcyclohexyl)phenyl]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCCCN1CCN(c2ccc(N3CCC4(CC3)OCCO4)cc2C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C29H47N3O2/c1-3-5-14-30-17-19-32(20-18-30)28-11-10-26(23-27(28)25-8-6-24(4-2)7-9-25)31-15-12-29(13-16-31)33-21-22-34-29/h10-11,23-25H,3-9,12-22H2,1-2H3 |
| InChIKey | PODGKZDAUIHMJH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|