C27H47ClN2O2 — CID 23141939
1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride (PubChem CID 23141939) has the molecular formula C27H47ClN2O2 and a molecular weight of 467.14 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride.
| Compound Name | 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 23141939 |
| Molecular Formula | C27H47ClN2O2 |
| Molecular Weight | 467.14 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride |
| SMILES | CCCCCN1CCN(c2cc(OC)c(OC)cc2C2CC(C)(C)CC(C)(C)C2)CC1.Cl |
| InChI | InChI=1S/C27H46N2O2.ClH/c1-8-9-10-11-28-12-14-29(15-13-28)23-17-25(31-7)24(30-6)16-22(23)21-18-26(2,3)20-27(4,5)19-21;/h16-17,21H,8-15,18-20H2,1-7H3;1H |
| InChIKey | XUNIRCNIFZSSJM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.14 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|