C25H42N2 — CID 23142693
1-pentyl-4-[2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine (PubChem CID 23142693) has the molecular formula C25H42N2 and a molecular weight of 370.63 g/mol. Its IUPAC name is 1-pentyl-4-[2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine.
| Compound Name | 1-pentyl-4-[2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
|---|---|
| PubChem CID | 23142693 |
| Molecular Formula | C25H42N2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 1-pentyl-4-[2-(3,3,5,5-tetramethylcyclohexyl)phenyl]piperazine |
| SMILES | CCCCCN1CCN(c2ccccc2C2CC(C)(C)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C25H42N2/c1-6-7-10-13-26-14-16-27(17-15-26)23-12-9-8-11-22(23)21-18-24(2,3)20-25(4,5)19-21/h8-9,11-12,21H,6-7,10,13-20H2,1-5H3 |
| InChIKey | IZWNRHIXFSMAJP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|