C26H45ClN2O — CID 23141674
1-[5-methoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride (PubChem CID 23141674) has the molecular formula C26H45ClN2O and a molecular weight of 437.11 g/mol. Its IUPAC name is 1-[5-methoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride.
| Compound Name | 1-[5-methoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 23141674 |
| Molecular Formula | C26H45ClN2O |
| Molecular Weight | 437.11 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 1-[5-methoxy-2-(3,3,5,5-tetramethylcyclohexyl)phenyl]-4-pentylpiperazine;hydrochloride |
| SMILES | CCCCCN1CCN(c2cc(OC)ccc2C2CC(C)(C)CC(C)(C)C2)CC1.Cl |
| InChI | InChI=1S/C26H44N2O.ClH/c1-7-8-9-12-27-13-15-28(16-14-27)24-17-22(29-6)10-11-23(24)21-18-25(2,3)20-26(4,5)19-21;/h10-11,17,21H,7-9,12-16,18-20H2,1-6H3;1H |
| InChIKey | JJNQCGDYNLTXBT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.11 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|