C25H40N2O2 — CID 11988824
1-butyl-4-[6-(3,3,5,5-tetramethylcyclohexyl)-1,3-benzodioxol-5-yl]piperazine (PubChem CID 11988824) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-butyl-4-[6-(3,3,5,5-tetramethylcyclohexyl)-1,3-benzodioxol-5-yl]piperazine.
| Compound Name | 1-butyl-4-[6-(3,3,5,5-tetramethylcyclohexyl)-1,3-benzodioxol-5-yl]piperazine |
|---|---|
| PubChem CID | 11988824 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 1-butyl-4-[6-(3,3,5,5-tetramethylcyclohexyl)-1,3-benzodioxol-5-yl]piperazine |
| SMILES | CCCCN1CCN(c2cc3c(cc2C2CC(C)(C)CC(C)(C)C2)OCO3)CC1 |
| InChI | InChI=1S/C25H40N2O2/c1-6-7-8-26-9-11-27(12-10-26)21-14-23-22(28-18-29-23)13-20(21)19-15-24(2,3)17-25(4,5)16-19/h13-14,19H,6-12,15-18H2,1-5H3 |
| InChIKey | VFKOMNDJZVQHFH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|