C14H13FN4O6S2 — CID 11304583
1-(4-fluorophenyl)sulfonyl-3-[(2-sulfamoylbenzoyl)amino]urea (PubChem CID 11304583) has the molecular formula C14H13FN4O6S2 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-[(2-sulfamoylbenzoyl)amino]urea.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-[(2-sulfamoylbenzoyl)amino]urea |
|---|---|
| PubChem CID | 11304583 |
| Molecular Formula | C14H13FN4O6S2 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-[(2-sulfamoylbenzoyl)amino]urea |
| SMILES | NS(=O)(=O)c1ccccc1C(=O)NNC(=O)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN4O6S2/c15-9-5-7-10(8-6-9)27(24,25)19-14(21)18-17-13(20)11-3-1-2-4-12(11)26(16,22)23/h1-8H,(H,17,20)(H2,16,22,23)(H2,18,19,21) |
| InChIKey | NNOQYOQAMVAXME-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|