C17H15ClN4O2S — CID 113045875
4-chloro-N-[6-(4-methylanilino)pyridazin-3-yl]benzenesulfonamide (PubChem CID 113045875) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is 4-chloro-N-[6-(4-methylanilino)pyridazin-3-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[6-(4-methylanilino)pyridazin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 113045875 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 4-chloro-N-[6-(4-methylanilino)pyridazin-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NS(=O)(=O)c3ccc(Cl)cc3)nn2)cc1 |
| InChI | InChI=1S/C17H15ClN4O2S/c1-12-2-6-14(7-3-12)19-16-10-11-17(21-20-16)22-25(23,24)15-8-4-13(18)5-9-15/h2-11H,1H3,(H,19,20)(H,21,22) |
| InChIKey | FHZZUCPZZXBZHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |