C18H17ClN4O2S — CID 113046483
3-chloro-N-[6-(3,5-dimethylanilino)pyridazin-3-yl]benzenesulfonamide (PubChem CID 113046483) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 3-chloro-N-[6-(3,5-dimethylanilino)pyridazin-3-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[6-(3,5-dimethylanilino)pyridazin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 113046483 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-chloro-N-[6-(3,5-dimethylanilino)pyridazin-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(C)cc(Nc2ccc(NS(=O)(=O)c3cccc(Cl)c3)nn2)c1 |
| InChI | InChI=1S/C18H17ClN4O2S/c1-12-8-13(2)10-15(9-12)20-17-6-7-18(22-21-17)23-26(24,25)16-5-3-4-14(19)11-16/h3-11H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | YAMZCJBMTWOSGA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |