C18H17FN4O2S — CID 113046610
N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 113046610) has the molecular formula C18H17FN4O2S and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 113046610 |
| Molecular Formula | C18H17FN4O2S |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | Cc1cccc(Nc2ccc(NS(=O)(=O)c3ccc(F)cc3)nn2)c1C |
| InChI | InChI=1S/C18H17FN4O2S/c1-12-4-3-5-16(13(12)2)20-17-10-11-18(22-21-17)23-26(24,25)15-8-6-14(19)7-9-15/h3-11H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | VADHQFMWEDJRLL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |