C16H12F2N4O2S — CID 113050545
N-[6-(2,4-difluoroanilino)pyridazin-3-yl]benzenesulfonamide (PubChem CID 113050545) has the molecular formula C16H12F2N4O2S and a molecular weight of 362.36 g/mol. Its IUPAC name is N-[6-(2,4-difluoroanilino)pyridazin-3-yl]benzenesulfonamide.
| Compound Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 113050545 |
| Molecular Formula | C16H12F2N4O2S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc(F)cc2F)nn1)c1ccccc1 |
| InChI | InChI=1S/C16H12F2N4O2S/c17-11-6-7-14(13(18)10-11)19-15-8-9-16(21-20-15)22-25(23,24)12-4-2-1-3-5-12/h1-10H,(H,19,20)(H,21,22) |
| InChIKey | FSGQQFXZAQXGAA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |