C16H14F2N4O2S2 — CID 113050558
N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide (PubChem CID 113050558) has the molecular formula C16H14F2N4O2S2 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113050558 |
| Molecular Formula | C16H14F2N4O2S2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(Nc3ccc(F)cc3F)nn2)s1 |
| InChI | InChI=1S/C16H14F2N4O2S2/c1-2-11-4-8-16(25-11)26(23,24)22-15-7-6-14(20-21-15)19-13-5-3-10(17)9-12(13)18/h3-9H,2H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | CZFDCNJXMBFRMP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |