C18H16F2N4O2S — CID 113050551
N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-2,4-dimethylbenzenesulfonamide (PubChem CID 113050551) has the molecular formula C18H16F2N4O2S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113050551 |
| Molecular Formula | C18H16F2N4O2S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[6-(2,4-difluoroanilino)pyridazin-3-yl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3ccc(F)cc3F)nn2)c(C)c1 |
| InChI | InChI=1S/C18H16F2N4O2S/c1-11-3-6-16(12(2)9-11)27(25,26)24-18-8-7-17(22-23-18)21-15-5-4-13(19)10-14(15)20/h3-10H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IADOTFKHADXLQL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |