C17H18N4O2S2 — CID 113046005
5-ethyl-N-[6-(N-methylanilino)pyridazin-3-yl]thiophene-2-sulfonamide (PubChem CID 113046005) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-ethyl-N-[6-(N-methylanilino)pyridazin-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[6-(N-methylanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113046005 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-ethyl-N-[6-(N-methylanilino)pyridazin-3-yl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(N(C)c3ccccc3)nn2)s1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-3-14-9-12-17(24-14)25(22,23)20-15-10-11-16(19-18-15)21(2)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3,(H,18,20) |
| InChIKey | SQDFXTUXAPKIML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |