C17H24N4O2S2 — CID 113044438
N-[6-(cycloheptylamino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide (PubChem CID 113044438) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[6-(cycloheptylamino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[6-(cycloheptylamino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113044438 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[6-(cycloheptylamino)pyridazin-3-yl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(NC3CCCCCC3)nn2)s1 |
| InChI | InChI=1S/C17H24N4O2S2/c1-2-14-9-12-17(24-14)25(22,23)21-16-11-10-15(19-20-16)18-13-7-5-3-4-6-8-13/h9-13H,2-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | IUSCGYYCIHPQKP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |