C24H36O6 — CID 11304708
[(1R,2R,3R)-2-[(1R,2S,3aR,8aS)-2-acetyloxy-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-3-hydroxy-4-oxocyclopentyl]methyl acetate (PubChem CID 11304708) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(1R,2R,3R)-2-[(1R,2S,3aR,8aS)-2-acetyloxy-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-3-hydroxy-4-oxocyclopentyl]methyl acetate.
| Compound Name | [(1R,2R,3R)-2-[(1R,2S,3aR,8aS)-2-acetyloxy-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-3-hydroxy-4-oxocyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 11304708 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(1R,2R,3R)-2-[(1R,2S,3aR,8aS)-2-acetyloxy-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulen-1-yl]-3-hydroxy-4-oxocyclopentyl]methyl acetate |
| SMILES | C=C1CCCC(C)(C)[C@@H]2C[C@H](OC(C)=O)[C@@](C)([C@H]3[C@H](COC(C)=O)CC(=O)[C@@H]3O)[C@H]12 |
| InChI | InChI=1S/C24H36O6/c1-13-8-7-9-23(4,5)17-11-19(30-15(3)26)24(6,20(13)17)21-16(12-29-14(2)25)10-18(27)22(21)28/h16-17,19-22,28H,1,7-12H2,2-6H3/t16-,17+,19-,20+,21-,22-,24+/m0/s1 |
| InChIKey | DDCSCNBIYSYOOO-DRBVDRALSA-N |
| XLogP | 3.46 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|