C13H17FN2O3S — CID 113052320
N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide (PubChem CID 113052320) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide.
| Compound Name | N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 113052320 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-[2-[(4-fluorophenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CCNS(=O)(=O)c1ccc(F)cc1)C(C)=O |
| InChI | InChI=1S/C13H17FN2O3S/c1-3-9-16(11(2)17)10-8-15-20(18,19)13-6-4-12(14)5-7-13/h3-7,15H,1,8-10H2,2H3 |
| InChIKey | SGJDJBHHSBUQQX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|