C15H22N2O4S — CID 113052336
N-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide (PubChem CID 113052336) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide.
| Compound Name | N-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 113052336 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]ethyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CCNS(=O)(=O)c1cc(C)ccc1OC)C(C)=O |
| InChI | InChI=1S/C15H22N2O4S/c1-5-9-17(13(3)18)10-8-16-22(19,20)15-11-12(2)6-7-14(15)21-4/h5-7,11,16H,1,8-10H2,2-4H3 |
| InChIKey | PONDCFJKZAKTSU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|