C12H15NO4S — CID 39368097
5-acetyl-2-methoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 39368097) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 5-acetyl-2-methoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 5-acetyl-2-methoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 39368097 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-acetyl-2-methoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(C)=O)ccc1OC |
| InChI | InChI=1S/C12H15NO4S/c1-4-7-13-18(15,16)12-8-10(9(2)14)5-6-11(12)17-3/h4-6,8,13H,1,7H2,2-3H3 |
| InChIKey | TYXUQSRQGWLLCM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|