C16H21BrN2O3 — CID 113053401
N-[2-[acetyl(oxolan-2-ylmethyl)amino]ethyl]-4-bromobenzamide (PubChem CID 113053401) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is N-[2-[acetyl(oxolan-2-ylmethyl)amino]ethyl]-4-bromobenzamide.
| Compound Name | N-[2-[acetyl(oxolan-2-ylmethyl)amino]ethyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 113053401 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[2-[acetyl(oxolan-2-ylmethyl)amino]ethyl]-4-bromobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(Br)cc1)CC1CCCO1 |
| InChI | InChI=1S/C16H21BrN2O3/c1-12(20)19(11-15-3-2-10-22-15)9-8-18-16(21)13-4-6-14(17)7-5-13/h4-7,15H,2-3,8-11H2,1H3,(H,18,21) |
| InChIKey | DDNVEGJMEOWDCC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |