C18H22N2O5 — CID 113053908
N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 113053908) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 113053908 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[2-[acetyl(furan-2-ylmethyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCN(Cc1ccco1)C(C)=O |
| InChI | InChI=1S/C18H22N2O5/c1-14(21)20(12-15-6-5-11-24-15)10-9-19-18(22)13-25-17-8-4-3-7-16(17)23-2/h3-8,11H,9-10,12-13H2,1-2H3,(H,19,22) |
| InChIKey | HIXBYVVHPNDUTD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |