C17H26N2O4 — CID 113056601
N-[2-[acetyl(tert-butyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 113056601) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is N-[2-[acetyl(tert-butyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[2-[acetyl(tert-butyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 113056601 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[2-[acetyl(tert-butyl)amino]ethyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCN(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-13(20)19(17(2,3)4)11-10-18-16(21)12-23-15-9-7-6-8-14(15)22-5/h6-9H,10-12H2,1-5H3,(H,18,21) |
| InChIKey | RBABDAYWHLORFF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |