C14H19NO5 — CID 110369950
N-[2-(1,3-dioxolan-2-yl)ethyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 110369950) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[2-(1,3-dioxolan-2-yl)ethyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[2-(1,3-dioxolan-2-yl)ethyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 110369950 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[2-(1,3-dioxolan-2-yl)ethyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NCCC1OCCO1 |
| InChI | InChI=1S/C14H19NO5/c1-17-11-4-2-3-5-12(11)20-10-13(16)15-7-6-14-18-8-9-19-14/h2-5,14H,6-10H2,1H3,(H,15,16) |
| InChIKey | OBHPJZJLOQJINR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |