C18H21N3O5S — CID 113053971
N-(furan-2-ylmethyl)-N-[2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]ethyl]acetamide (PubChem CID 113053971) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 113053971 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[2-[(1-methyl-2-oxo-3H-indol-5-yl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)N(CCNS(=O)(=O)c1ccc2c(c1)CC(=O)N2C)Cc1ccco1 |
| InChI | InChI=1S/C18H21N3O5S/c1-13(22)21(12-15-4-3-9-26-15)8-7-19-27(24,25)16-5-6-17-14(10-16)11-18(23)20(17)2/h3-6,9-10,19H,7-8,11-12H2,1-2H3 |
| InChIKey | BMJAXKMKUCXHJS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |