C16H16ClN3O2 — CID 113059444
N-[2-(N-acetyl-2-chloroanilino)ethyl]pyridine-3-carboxamide (PubChem CID 113059444) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-[2-(N-acetyl-2-chloroanilino)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(N-acetyl-2-chloroanilino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113059444 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[2-(N-acetyl-2-chloroanilino)ethyl]pyridine-3-carboxamide |
| SMILES | CC(=O)N(CCNC(=O)c1cccnc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClN3O2/c1-12(21)20(15-7-3-2-6-14(15)17)10-9-19-16(22)13-5-4-8-18-11-13/h2-8,11H,9-10H2,1H3,(H,19,22) |
| InChIKey | NXBGXWOLSQJRID-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |