C15H22ClN3O3 — CID 113060254
N-(3-chloro-4-methoxyphenyl)-N-[2-(propan-2-ylcarbamoylamino)ethyl]acetamide (PubChem CID 113060254) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-[2-(propan-2-ylcarbamoylamino)ethyl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N-[2-(propan-2-ylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113060254 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N-[2-(propan-2-ylcarbamoylamino)ethyl]acetamide |
| SMILES | COc1ccc(N(CCNC(=O)NC(C)C)C(C)=O)cc1Cl |
| InChI | InChI=1S/C15H22ClN3O3/c1-10(2)18-15(21)17-7-8-19(11(3)20)12-5-6-14(22-4)13(16)9-12/h5-6,9-10H,7-8H2,1-4H3,(H2,17,18,21) |
| InChIKey | KVMFXLPHKJJHRG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |