C16H19F3N2O3 — CID 113061366
N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide (PubChem CID 113061366) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 113061366 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]oxolane-2-carboxamide |
| SMILES | CC(=O)N(CCNC(=O)C1CCCO1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O3/c1-11(22)21(9-8-20-15(23)14-7-4-10-24-14)13-6-3-2-5-12(13)16(17,18)19/h2-3,5-6,14H,4,7-10H2,1H3,(H,20,23) |
| InChIKey | ISZSOSHUOZRZFZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |