C19H19F3N2O2 — CID 113061372
N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]-2-methylbenzamide (PubChem CID 113061372) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]-2-methylbenzamide.
| Compound Name | N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 113061372 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[2-[N-acetyl-2-(trifluoromethyl)anilino]ethyl]-2-methylbenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccccc1C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O2/c1-13-7-3-4-8-15(13)18(26)23-11-12-24(14(2)25)17-10-6-5-9-16(17)19(20,21)22/h3-10H,11-12H2,1-2H3,(H,23,26) |
| InChIKey | WZKJJNSKZQMLQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |