C27H31N5O5 — CID 11306697
diethyl (2S)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate (PubChem CID 11306697) has the molecular formula C27H31N5O5 and a molecular weight of 505.58 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
|---|---|
| PubChem CID | 11306697 |
| Molecular Formula | C27H31N5O5 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | diethyl (2S)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioate |
| SMILES | C=C(C[C@H](NC(=O)c1ccc(CCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H31N5O5/c1-4-36-25(34)16(3)14-22(26(35)37-5-2)30-24(33)19-11-8-17(9-12-19)6-7-18-10-13-21-20(15-18)23(28)32-27(29)31-21/h8-13,15,22H,3-7,14H2,1-2H3,(H,30,33)(H4,28,29,31,32)/t22-/m0/s1 |
| InChIKey | COIGYSFWURAAIG-QFIPXVFZSA-N |
| XLogP | 2.75 |
| TPSA | 159.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|