C16H21N3O4S2 — CID 113067479
3-methyl-N-[2-[methylsulfonyl(pyridin-4-ylmethyl)amino]ethyl]benzenesulfonamide (PubChem CID 113067479) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-methyl-N-[2-[methylsulfonyl(pyridin-4-ylmethyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[2-[methylsulfonyl(pyridin-4-ylmethyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113067479 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-methyl-N-[2-[methylsulfonyl(pyridin-4-ylmethyl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCCN(Cc2ccncc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-14-4-3-5-16(12-14)25(22,23)18-10-11-19(24(2,20)21)13-15-6-8-17-9-7-15/h3-9,12,18H,10-11,13H2,1-2H3 |
| InChIKey | LBKIXHULPLAOKB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |