C15H24N2O5S2 — CID 113066210
3-methyl-N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]benzenesulfonamide (PubChem CID 113066210) has the molecular formula C15H24N2O5S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-methyl-N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113066210 |
| Molecular Formula | C15H24N2O5S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3-methyl-N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCCN(CC2CCCO2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O5S2/c1-13-5-3-7-15(11-13)24(20,21)16-8-9-17(23(2,18)19)12-14-6-4-10-22-14/h3,5,7,11,14,16H,4,6,8-10,12H2,1-2H3 |
| InChIKey | USRKGIDEPAEPAW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |