C12H26N2O5S2 — CID 113066194
N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]butane-1-sulfonamide (PubChem CID 113066194) has the molecular formula C12H26N2O5S2 and a molecular weight of 342.48 g/mol. Its IUPAC name is N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113066194 |
| Molecular Formula | C12H26N2O5S2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[2-[methylsulfonyl(oxolan-2-ylmethyl)amino]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCN(CC1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O5S2/c1-3-4-10-21(17,18)13-7-8-14(20(2,15)16)11-12-6-5-9-19-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | WBLFLVBUSBKOFO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |