C13H23N3O4S2 — CID 113067541
N-[2-(dimethylsulfamoylamino)ethyl]-N-(2-phenylethyl)methanesulfonamide (PubChem CID 113067541) has the molecular formula C13H23N3O4S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoylamino)ethyl]-N-(2-phenylethyl)methanesulfonamide.
| Compound Name | N-[2-(dimethylsulfamoylamino)ethyl]-N-(2-phenylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 113067541 |
| Molecular Formula | C13H23N3O4S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[2-(dimethylsulfamoylamino)ethyl]-N-(2-phenylethyl)methanesulfonamide |
| SMILES | CN(C)S(=O)(=O)NCCN(CCc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H23N3O4S2/c1-15(2)22(19,20)14-10-12-16(21(3,17)18)11-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | JYTHFOBDNWOJQV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |