C14H23FN2O4S2 — CID 113067596
N-[2-[2-(2-fluorophenyl)ethyl-methylsulfonylamino]ethyl]propane-1-sulfonamide (PubChem CID 113067596) has the molecular formula C14H23FN2O4S2 and a molecular weight of 366.48 g/mol. Its IUPAC name is N-[2-[2-(2-fluorophenyl)ethyl-methylsulfonylamino]ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-[2-(2-fluorophenyl)ethyl-methylsulfonylamino]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113067596 |
| Molecular Formula | C14H23FN2O4S2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[2-[2-(2-fluorophenyl)ethyl-methylsulfonylamino]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCN(CCc1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H23FN2O4S2/c1-3-12-23(20,21)16-9-11-17(22(2,18)19)10-8-13-6-4-5-7-14(13)15/h4-7,16H,3,8-12H2,1-2H3 |
| InChIKey | YYSFIZKKGRSJJT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |