C10H24N2O4S2 — CID 113068070
N-[2-[tert-butyl(methylsulfonyl)amino]ethyl]propane-1-sulfonamide (PubChem CID 113068070) has the molecular formula C10H24N2O4S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[2-[tert-butyl(methylsulfonyl)amino]ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-[tert-butyl(methylsulfonyl)amino]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113068070 |
| Molecular Formula | C10H24N2O4S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-[2-[tert-butyl(methylsulfonyl)amino]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCN(C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O4S2/c1-6-9-18(15,16)11-7-8-12(10(2,3)4)17(5,13)14/h11H,6-9H2,1-5H3 |
| InChIKey | UDADWRWWCXLWSG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |