C21H25N3O3S — CID 113068984
N-[2-(3,5-dimethyl-N-methylsulfonylanilino)ethyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 113068984) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-N-methylsulfonylanilino)ethyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[2-(3,5-dimethyl-N-methylsulfonylanilino)ethyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113068984 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[2-(3,5-dimethyl-N-methylsulfonylanilino)ethyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | Cc1cc(C)cc(N(CCNC(=O)Cc2c[nH]c3ccccc23)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-15-10-16(2)12-18(11-15)24(28(3,26)27)9-8-22-21(25)13-17-14-23-20-7-5-4-6-19(17)20/h4-7,10-12,14,23H,8-9,13H2,1-3H3,(H,22,25) |
| InChIKey | SBRJVEMOZOCLLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |