C17H28N2O3S — CID 113069035
N-[2-(2,6-dimethyl-N-methylsulfonylanilino)ethyl]-2-ethylbutanamide (PubChem CID 113069035) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethyl-N-methylsulfonylanilino)ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-(2,6-dimethyl-N-methylsulfonylanilino)ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113069035 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[2-(2,6-dimethyl-N-methylsulfonylanilino)ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCN(c1c(C)cccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C17H28N2O3S/c1-6-15(7-2)17(20)18-11-12-19(23(5,21)22)16-13(3)9-8-10-14(16)4/h8-10,15H,6-7,11-12H2,1-5H3,(H,18,20) |
| InChIKey | BNRIKQXUJILGMI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |