C19H32N2O3S — CID 113069547
2-ethyl-N-[2-(2-methyl-N-methylsulfonyl-6-propan-2-ylanilino)ethyl]butanamide (PubChem CID 113069547) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 2-ethyl-N-[2-(2-methyl-N-methylsulfonyl-6-propan-2-ylanilino)ethyl]butanamide.
| Compound Name | 2-ethyl-N-[2-(2-methyl-N-methylsulfonyl-6-propan-2-ylanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 113069547 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-ethyl-N-[2-(2-methyl-N-methylsulfonyl-6-propan-2-ylanilino)ethyl]butanamide |
| SMILES | CCC(CC)C(=O)NCCN(c1c(C)cccc1C(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C19H32N2O3S/c1-7-16(8-2)19(22)20-12-13-21(25(6,23)24)18-15(5)10-9-11-17(18)14(3)4/h9-11,14,16H,7-8,12-13H2,1-6H3,(H,20,22) |
| InChIKey | SCPSJZGODLJDPQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |