C15H17ClN2O4S2 — CID 113070260
N-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)ethyl]thiophene-2-carboxamide (PubChem CID 113070260) has the molecular formula C15H17ClN2O4S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113070260 |
| Molecular Formula | C15H17ClN2O4S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(N(CCNC(=O)c2cccs2)S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H17ClN2O4S2/c1-22-13-6-5-11(10-12(13)16)18(24(2,20)21)8-7-17-15(19)14-4-3-9-23-14/h3-6,9-10H,7-8H2,1-2H3,(H,17,19) |
| InChIKey | XBXWMYUJXHITNH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |