C25H25F4N3O7 — CID 11307441
[(5R)-3-[4-[4-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 2-aminoacetate;2,2,2-trifluoroethane-1,1-diol (PubChem CID 11307441) has the molecular formula C25H25F4N3O7 and a molecular weight of 555.48 g/mol. Its IUPAC name is [(5R)-3-[4-[4-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 2-aminoacetate;2,2,2-trifluoroethane-1,1-diol.
| Compound Name | [(5R)-3-[4-[4-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 2-aminoacetate;2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 11307441 |
| Molecular Formula | C25H25F4N3O7 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | [(5R)-3-[4-[4-(4,5-dimethyl-1,3-oxazol-2-yl)phenyl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl 2-aminoacetate;2,2,2-trifluoroethane-1,1-diol |
| SMILES | Cc1nc(-c2ccc(-c3ccc(N4C[C@H](COC(=O)CN)OC4=O)cc3F)cc2)oc1C.OC(O)C(F)(F)F |
| InChI | InChI=1S/C23H22FN3O5.C2H3F3O2/c1-13-14(2)31-22(26-13)16-5-3-15(4-6-16)19-8-7-17(9-20(19)24)27-11-18(32-23(27)29)12-30-21(28)10-25;3-2(4,5)1(6)7/h3-9,18H,10-12,25H2,1-2H3;1,6-7H/t18-;/m1./s1 |
| InChIKey | KADWAEIDVNILQV-GMUIIQOCSA-N |
| XLogP | 3.45 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|