C21H22FN5O5 — CID 91462402
[[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-aminomethylidene]amino] 2-aminoacetate (PubChem CID 91462402) has the molecular formula C21H22FN5O5 and a molecular weight of 443.44 g/mol. Its IUPAC name is [[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-aminomethylidene]amino] 2-aminoacetate.
| Compound Name | [[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-aminomethylidene]amino] 2-aminoacetate |
|---|---|
| PubChem CID | 91462402 |
| Molecular Formula | C21H22FN5O5 |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]-aminomethylidene]amino] 2-aminoacetate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(C(N)=NOC(=O)CN)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H22FN5O5/c1-12(28)25-10-16-11-27(21(30)31-16)15-6-7-17(18(22)8-15)13-2-4-14(5-3-13)20(24)26-32-19(29)9-23/h2-8,16H,9-11,23H2,1H3,(H2,24,26)(H,25,28)/t16-/m0/s1 |
| InChIKey | FHDWQORTNAJTGR-INIZCTEOSA-N |
| XLogP | 1.08 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|