C23H25FN4O6 — CID 24993368
[[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzoyl]amino] 4-aminobutanoate (PubChem CID 24993368) has the molecular formula C23H25FN4O6 and a molecular weight of 472.47 g/mol. Its IUPAC name is [[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzoyl]amino] 4-aminobutanoate.
| Compound Name | [[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzoyl]amino] 4-aminobutanoate |
|---|---|
| PubChem CID | 24993368 |
| Molecular Formula | C23H25FN4O6 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]benzoyl]amino] 4-aminobutanoate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(C(=O)NOC(=O)CCCN)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H25FN4O6/c1-14(29)26-12-18-13-28(23(32)33-18)17-8-9-19(20(24)11-17)15-4-6-16(7-5-15)22(31)27-34-21(30)3-2-10-25/h4-9,11,18H,2-3,10,12-13,25H2,1H3,(H,26,29)(H,27,31)/t18-/m0/s1 |
| InChIKey | PXVCBMBRXMESSJ-SFHVURJKSA-N |
| XLogP | 1.88 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|